C21H19N3O5 — CID 55648126
N-[2-oxo-2-[2-[2-(2-phenylphenoxy)acetyl]hydrazinyl]ethyl]furan-3-carboxamide (PubChem CID 55648126) has the molecular formula C21H19N3O5 and a molecular weight of 393.40 g/mol. Its IUPAC name is N-[2-oxo-2-[2-[2-(2-phenylphenoxy)acetyl]hydrazinyl]ethyl]furan-3-carboxamide.
| Compound Name | N-[2-oxo-2-[2-[2-(2-phenylphenoxy)acetyl]hydrazinyl]ethyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 55648126 |
| Molecular Formula | C21H19N3O5 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | N-[2-oxo-2-[2-[2-(2-phenylphenoxy)acetyl]hydrazinyl]ethyl]furan-3-carboxamide |
| SMILES | O=C(CNC(=O)c1ccoc1)NNC(=O)COc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C21H19N3O5/c25-19(12-22-21(27)16-10-11-28-13-16)23-24-20(26)14-29-18-9-5-4-8-17(18)15-6-2-1-3-7-15/h1-11,13H,12,14H2,(H,22,27)(H,23,25)(H,24,26) |
| InChIKey | OSNIZWCZSJPGFD-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|