C23H25F2N3O5 — CID 55656295
N-[1-[2-(difluoromethoxy)phenyl]propyl]-2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 55656295) has the molecular formula C23H25F2N3O5 and a molecular weight of 461.47 g/mol. Its IUPAC name is N-[1-[2-(difluoromethoxy)phenyl]propyl]-2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-[1-[2-(difluoromethoxy)phenyl]propyl]-2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 55656295 |
| Molecular Formula | C23H25F2N3O5 |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | N-[1-[2-(difluoromethoxy)phenyl]propyl]-2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CCC(NC(=O)CN1C(=O)NC(C)(c2ccc(OC)cc2)C1=O)c1ccccc1OC(F)F |
| InChI | InChI=1S/C23H25F2N3O5/c1-4-17(16-7-5-6-8-18(16)33-21(24)25)26-19(29)13-28-20(30)23(2,27-22(28)31)14-9-11-15(32-3)12-10-14/h5-12,17,21H,4,13H2,1-3H3,(H,26,29)(H,27,31) |
| InChIKey | UMQCFBALXOOPER-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|