C23H34N4O4 — CID 55658378
2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]-N-[1-[2-oxo-2-(propylamino)ethyl]piperidin-4-yl]propanamide (PubChem CID 55658378) has the molecular formula C23H34N4O4 and a molecular weight of 430.55 g/mol. Its IUPAC name is 2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]-N-[1-[2-oxo-2-(propylamino)ethyl]piperidin-4-yl]propanamide.
| Compound Name | 2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]-N-[1-[2-oxo-2-(propylamino)ethyl]piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 55658378 |
| Molecular Formula | C23H34N4O4 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | 2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]-N-[1-[2-oxo-2-(propylamino)ethyl]piperidin-4-yl]propanamide |
| SMILES | CCCNC(=O)CN1CCC(NC(=O)C(C)NC(=O)/C=C/c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C23H34N4O4/c1-4-13-24-22(29)16-27-14-11-19(12-15-27)26-23(30)17(2)25-21(28)10-7-18-5-8-20(31-3)9-6-18/h5-10,17,19H,4,11-16H2,1-3H3,(H,24,29)(H,25,28)(H,26,30)/b10-7+ |
| InChIKey | CGEQACLELLSRFW-JXMROGBWSA-N |
| XLogP | 1.32 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|