C21H30N4O3S2 — CID 55659009
N-[3-methyl-2-(4-methylpiperidin-1-yl)butyl]-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide (PubChem CID 55659009) has the molecular formula C21H30N4O3S2 and a molecular weight of 450.63 g/mol. Its IUPAC name is N-[3-methyl-2-(4-methylpiperidin-1-yl)butyl]-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide.
| Compound Name | N-[3-methyl-2-(4-methylpiperidin-1-yl)butyl]-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide |
|---|---|
| PubChem CID | 55659009 |
| Molecular Formula | C21H30N4O3S2 |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | N-[3-methyl-2-(4-methylpiperidin-1-yl)butyl]-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide |
| SMILES | CC1CCN(C(CNC(=O)c2ccc3c(c2)SC2=NS(=O)(=O)CCN23)C(C)C)CC1 |
| InChI | InChI=1S/C21H30N4O3S2/c1-14(2)18(24-8-6-15(3)7-9-24)13-22-20(26)16-4-5-17-19(12-16)29-21-23-30(27,28)11-10-25(17)21/h4-5,12,14-15,18H,6-11,13H2,1-3H3,(H,22,26) |
| InChIKey | NNZGSPNBDHLQOH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |