C22H27N3O4 — CID 55659546
N-[(2-cyclopentyloxy-4-pyridinyl)methyl]-1-(furan-3-carbonyl)piperidine-4-carboxamide (PubChem CID 55659546) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is N-[(2-cyclopentyloxy-4-pyridinyl)methyl]-1-(furan-3-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-[(2-cyclopentyloxy-4-pyridinyl)methyl]-1-(furan-3-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55659546 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | N-[(2-cyclopentyloxy-4-pyridinyl)methyl]-1-(furan-3-carbonyl)piperidine-4-carboxamide |
| SMILES | O=C(NCc1ccnc(OC2CCCC2)c1)C1CCN(C(=O)c2ccoc2)CC1 |
| InChI | InChI=1S/C22H27N3O4/c26-21(17-6-10-25(11-7-17)22(27)18-8-12-28-15-18)24-14-16-5-9-23-20(13-16)29-19-3-1-2-4-19/h5,8-9,12-13,15,17,19H,1-4,6-7,10-11,14H2,(H,24,26) |
| InChIKey | YCOSKEHQYSFQNN-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |