C20H27ClN2O5 — CID 55663345
methyl 1-[2-(5-chloro-2,4-dimethoxyanilino)-2-oxoethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate (PubChem CID 55663345) has the molecular formula C20H27ClN2O5 and a molecular weight of 410.90 g/mol. Its IUPAC name is methyl 1-[2-(5-chloro-2,4-dimethoxyanilino)-2-oxoethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate.
| Compound Name | methyl 1-[2-(5-chloro-2,4-dimethoxyanilino)-2-oxoethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
|---|---|
| PubChem CID | 55663345 |
| Molecular Formula | C20H27ClN2O5 |
| Molecular Weight | 410.90 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | methyl 1-[2-(5-chloro-2,4-dimethoxyanilino)-2-oxoethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
| SMILES | COC(=O)C1CC2CCCCC2N1CC(=O)Nc1cc(Cl)c(OC)cc1OC |
| InChI | InChI=1S/C20H27ClN2O5/c1-26-17-10-18(27-2)14(9-13(17)21)22-19(24)11-23-15-7-5-4-6-12(15)8-16(23)20(25)28-3/h9-10,12,15-16H,4-8,11H2,1-3H3,(H,22,24) |
| InChIKey | JZZIQSCRLVUHGD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.90 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |