C17H24ClN3O3 — CID 136582407
2-[(3aS,6aS)-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-N-(5-chloro-2,4-dimethoxyphenyl)acetamide (PubChem CID 136582407) has the molecular formula C17H24ClN3O3 and a molecular weight of 353.85 g/mol. Its IUPAC name is 2-[(3aS,6aS)-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-N-(5-chloro-2,4-dimethoxyphenyl)acetamide.
| Compound Name | 2-[(3aS,6aS)-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-N-(5-chloro-2,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 136582407 |
| Molecular Formula | C17H24ClN3O3 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 2-[(3aS,6aS)-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-N-(5-chloro-2,4-dimethoxyphenyl)acetamide |
| SMILES | COc1cc(OC)c(NC(=O)CN2C[C@@H]3CCN(C)[C@@H]3C2)cc1Cl |
| InChI | InChI=1S/C17H24ClN3O3/c1-20-5-4-11-8-21(9-14(11)20)10-17(22)19-13-6-12(18)15(23-2)7-16(13)24-3/h6-7,11,14H,4-5,8-10H2,1-3H3,(H,19,22)/t11-,14+/m0/s1 |
| InChIKey | YNHGYLVBAAESLP-SMDDNHRTSA-N |
| XLogP | 1.93 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |