C21H31N3O5 — CID 55664293
N-(2-methoxyethyl)-2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-pentan-3-ylacetamide (PubChem CID 55664293) has the molecular formula C21H31N3O5 and a molecular weight of 405.50 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-pentan-3-ylacetamide.
| Compound Name | N-(2-methoxyethyl)-2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-pentan-3-ylacetamide |
|---|---|
| PubChem CID | 55664293 |
| Molecular Formula | C21H31N3O5 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | N-(2-methoxyethyl)-2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-pentan-3-ylacetamide |
| SMILES | CCC(CC)N(CCOC)C(=O)CN1C(=O)NC(C)(c2ccc(OC)cc2)C1=O |
| InChI | InChI=1S/C21H31N3O5/c1-6-16(7-2)23(12-13-28-4)18(25)14-24-19(26)21(3,22-20(24)27)15-8-10-17(29-5)11-9-15/h8-11,16H,6-7,12-14H2,1-5H3,(H,22,27) |
| InChIKey | RWGOEWUWXCXZNK-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|