C18H19F3N4O5S2 — CID 55666815
N-methyl-N-[2-oxo-2-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]ethyl]pyridine-3-sulfonamide (PubChem CID 55666815) has the molecular formula C18H19F3N4O5S2 and a molecular weight of 492.50 g/mol. Its IUPAC name is N-methyl-N-[2-oxo-2-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]ethyl]pyridine-3-sulfonamide.
| Compound Name | N-methyl-N-[2-oxo-2-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]ethyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 55666815 |
| Molecular Formula | C18H19F3N4O5S2 |
| Molecular Weight | 492.50 g/mol |
| Exact Mass | 492.07 |
| IUPAC Name | N-methyl-N-[2-oxo-2-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]ethyl]pyridine-3-sulfonamide |
| SMILES | CN(CC(=O)N1CCN(S(=O)(=O)c2ccc(F)c(F)c2F)CC1)S(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C18H19F3N4O5S2/c1-23(31(27,28)13-3-2-6-22-11-13)12-16(26)24-7-9-25(10-8-24)32(29,30)15-5-4-14(19)17(20)18(15)21/h2-6,11H,7-10,12H2,1H3 |
| InChIKey | UGTQXWWTIPKWRW-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 107.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.50 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|