C24H36N2O4S — CID 55673136
[1-(4-ethoxyphenyl)sulfonylpiperidin-4-yl]-(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)methanone (PubChem CID 55673136) has the molecular formula C24H36N2O4S and a molecular weight of 448.63 g/mol. Its IUPAC name is [1-(4-ethoxyphenyl)sulfonylpiperidin-4-yl]-(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)methanone.
| Compound Name | [1-(4-ethoxyphenyl)sulfonylpiperidin-4-yl]-(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)methanone |
|---|---|
| PubChem CID | 55673136 |
| Molecular Formula | C24H36N2O4S |
| Molecular Weight | 448.63 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | [1-(4-ethoxyphenyl)sulfonylpiperidin-4-yl]-(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)methanone |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCC(C(=O)N3CCC(C)C4CCCCC43)CC2)cc1 |
| InChI | InChI=1S/C24H36N2O4S/c1-3-30-20-8-10-21(11-9-20)31(28,29)25-15-13-19(14-16-25)24(27)26-17-12-18(2)22-6-4-5-7-23(22)26/h8-11,18-19,22-23H,3-7,12-17H2,1-2H3 |
| InChIKey | FEZYHWQZTHMWEI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.63 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |