C16H25N5O3 — CID 55681402
methyl 1-[[4-(2-cyclopentylacetyl)piperazin-1-yl]methyl]triazole-4-carboxylate (PubChem CID 55681402) has the molecular formula C16H25N5O3 and a molecular weight of 335.41 g/mol. Its IUPAC name is methyl 1-[[4-(2-cyclopentylacetyl)piperazin-1-yl]methyl]triazole-4-carboxylate.
| Compound Name | methyl 1-[[4-(2-cyclopentylacetyl)piperazin-1-yl]methyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 55681402 |
| Molecular Formula | C16H25N5O3 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | methyl 1-[[4-(2-cyclopentylacetyl)piperazin-1-yl]methyl]triazole-4-carboxylate |
| SMILES | COC(=O)c1cn(CN2CCN(C(=O)CC3CCCC3)CC2)nn1 |
| InChI | InChI=1S/C16H25N5O3/c1-24-16(23)14-11-21(18-17-14)12-19-6-8-20(9-7-19)15(22)10-13-4-2-3-5-13/h11,13H,2-10,12H2,1H3 |
| InChIKey | FALSRLGELDEWOR-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |