C18H19Cl2N3O3 — CID 55683652
3-[5-(2,4-dichlorophenyl)-1,3-oxazol-2-yl]-N-(2-oxoazepan-3-yl)propanamide (PubChem CID 55683652) has the molecular formula C18H19Cl2N3O3 and a molecular weight of 396.27 g/mol. Its IUPAC name is 3-[5-(2,4-dichlorophenyl)-1,3-oxazol-2-yl]-N-(2-oxoazepan-3-yl)propanamide.
| Compound Name | 3-[5-(2,4-dichlorophenyl)-1,3-oxazol-2-yl]-N-(2-oxoazepan-3-yl)propanamide |
|---|---|
| PubChem CID | 55683652 |
| Molecular Formula | C18H19Cl2N3O3 |
| Molecular Weight | 396.27 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 3-[5-(2,4-dichlorophenyl)-1,3-oxazol-2-yl]-N-(2-oxoazepan-3-yl)propanamide |
| SMILES | O=C(CCc1ncc(-c2ccc(Cl)cc2Cl)o1)NC1CCCCNC1=O |
| InChI | InChI=1S/C18H19Cl2N3O3/c19-11-4-5-12(13(20)9-11)15-10-22-17(26-15)7-6-16(24)23-14-3-1-2-8-21-18(14)25/h4-5,9-10,14H,1-3,6-8H2,(H,21,25)(H,23,24) |
| InChIKey | XGDYQCDFPSDTEE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.27 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |