C19H15F2N5O4 — CID 55683683
N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]-1-(3-nitrophenyl)pyrazole-3-carboxamide (PubChem CID 55683683) has the molecular formula C19H15F2N5O4 and a molecular weight of 415.36 g/mol. Its IUPAC name is N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]-1-(3-nitrophenyl)pyrazole-3-carboxamide.
| Compound Name | N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]-1-(3-nitrophenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 55683683 |
| Molecular Formula | C19H15F2N5O4 |
| Molecular Weight | 415.36 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]-1-(3-nitrophenyl)pyrazole-3-carboxamide |
| SMILES | CNC(=O)C(NC(=O)c1ccn(-c2cccc([N+](=O)[O-])c2)n1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H15F2N5O4/c1-22-19(28)17(11-5-6-14(20)15(21)9-11)23-18(27)16-7-8-25(24-16)12-3-2-4-13(10-12)26(29)30/h2-10,17H,1H3,(H,22,28)(H,23,27) |
| InChIKey | HQJUQUJRSVDLQB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|