C23H26ClN3O4S — CID 55684907
N-[4-chloro-3-(diethylsulfamoyl)phenyl]-4-(5-phenyl-1,3-oxazol-2-yl)butanamide (PubChem CID 55684907) has the molecular formula C23H26ClN3O4S and a molecular weight of 476.00 g/mol. Its IUPAC name is N-[4-chloro-3-(diethylsulfamoyl)phenyl]-4-(5-phenyl-1,3-oxazol-2-yl)butanamide.
| Compound Name | N-[4-chloro-3-(diethylsulfamoyl)phenyl]-4-(5-phenyl-1,3-oxazol-2-yl)butanamide |
|---|---|
| PubChem CID | 55684907 |
| Molecular Formula | C23H26ClN3O4S |
| Molecular Weight | 476.00 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | N-[4-chloro-3-(diethylsulfamoyl)phenyl]-4-(5-phenyl-1,3-oxazol-2-yl)butanamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)CCCc2ncc(-c3ccccc3)o2)ccc1Cl |
| InChI | InChI=1S/C23H26ClN3O4S/c1-3-27(4-2)32(29,30)21-15-18(13-14-19(21)24)26-22(28)11-8-12-23-25-16-20(31-23)17-9-6-5-7-10-17/h5-7,9-10,13-16H,3-4,8,11-12H2,1-2H3,(H,26,28) |
| InChIKey | MQPJJBDATPSVME-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.00 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |