C19H24BrNO4 — CID 55694184
4-bromo-N-[(4-butoxy-3-methoxyphenyl)methyl]-2,5-dimethylfuran-3-carboxamide (PubChem CID 55694184) has the molecular formula C19H24BrNO4 and a molecular weight of 410.31 g/mol. Its IUPAC name is 4-bromo-N-[(4-butoxy-3-methoxyphenyl)methyl]-2,5-dimethylfuran-3-carboxamide.
| Compound Name | 4-bromo-N-[(4-butoxy-3-methoxyphenyl)methyl]-2,5-dimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 55694184 |
| Molecular Formula | C19H24BrNO4 |
| Molecular Weight | 410.31 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 4-bromo-N-[(4-butoxy-3-methoxyphenyl)methyl]-2,5-dimethylfuran-3-carboxamide |
| SMILES | CCCCOc1ccc(CNC(=O)c2c(C)oc(C)c2Br)cc1OC |
| InChI | InChI=1S/C19H24BrNO4/c1-5-6-9-24-15-8-7-14(10-16(15)23-4)11-21-19(22)17-12(2)25-13(3)18(17)20/h7-8,10H,5-6,9,11H2,1-4H3,(H,21,22) |
| InChIKey | DFVWXBAAOXZJBH-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.31 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|