C20H24N4O4 — CID 55694215
1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-[3-(furan-2-ylmethoxy)propyl]urea (PubChem CID 55694215) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-[3-(furan-2-ylmethoxy)propyl]urea.
| Compound Name | 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-[3-(furan-2-ylmethoxy)propyl]urea |
|---|---|
| PubChem CID | 55694215 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-[3-(furan-2-ylmethoxy)propyl]urea |
| SMILES | Cc1c(NC(=O)NCCCOCc2ccco2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C20H24N4O4/c1-15-18(19(25)24(23(15)2)16-8-4-3-5-9-16)22-20(26)21-11-7-12-27-14-17-10-6-13-28-17/h3-6,8-10,13H,7,11-12,14H2,1-2H3,(H2,21,22,26) |
| InChIKey | ROSRDGVBZOTDJA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 90.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|