C18H20N6O2S2 — CID 8654220
1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-(furan-2-ylmethylcarbamothioylamino)thiourea (PubChem CID 8654220) has the molecular formula C18H20N6O2S2 and a molecular weight of 416.53 g/mol. Its IUPAC name is 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-(furan-2-ylmethylcarbamothioylamino)thiourea.
| Compound Name | 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-(furan-2-ylmethylcarbamothioylamino)thiourea |
|---|---|
| PubChem CID | 8654220 |
| Molecular Formula | C18H20N6O2S2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-(furan-2-ylmethylcarbamothioylamino)thiourea |
| SMILES | Cc1c(NC(=S)NNC(=S)NCc2ccco2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C18H20N6O2S2/c1-12-15(16(25)24(23(12)2)13-7-4-3-5-8-13)20-18(28)22-21-17(27)19-11-14-9-6-10-26-14/h3-10H,11H2,1-2H3,(H2,19,21,27)(H2,20,22,28) |
| InChIKey | TZKAKKCLNHGCQQ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 88.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|