C19H22N4O4S — CID 55699026
1-[2-(2-oxopyrrolidin-1-yl)phenyl]-3-[2-(4-sulfamoylphenyl)ethyl]urea (PubChem CID 55699026) has the molecular formula C19H22N4O4S and a molecular weight of 402.48 g/mol. Its IUPAC name is 1-[2-(2-oxopyrrolidin-1-yl)phenyl]-3-[2-(4-sulfamoylphenyl)ethyl]urea.
| Compound Name | 1-[2-(2-oxopyrrolidin-1-yl)phenyl]-3-[2-(4-sulfamoylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 55699026 |
| Molecular Formula | C19H22N4O4S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 1-[2-(2-oxopyrrolidin-1-yl)phenyl]-3-[2-(4-sulfamoylphenyl)ethyl]urea |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)Nc2ccccc2N2CCCC2=O)cc1 |
| InChI | InChI=1S/C19H22N4O4S/c20-28(26,27)15-9-7-14(8-10-15)11-12-21-19(25)22-16-4-1-2-5-17(16)23-13-3-6-18(23)24/h1-2,4-5,7-10H,3,6,11-13H2,(H2,20,26,27)(H2,21,22,25) |
| InChIKey | YRQSLEBYHFQKMT-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |