C26H26ClN3O3 — CID 55709282
1-(4-chlorobenzoyl)-N-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]piperidine-3-carboxamide (PubChem CID 55709282) has the molecular formula C26H26ClN3O3 and a molecular weight of 463.97 g/mol. Its IUPAC name is 1-(4-chlorobenzoyl)-N-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]piperidine-3-carboxamide.
| Compound Name | 1-(4-chlorobenzoyl)-N-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55709282 |
| Molecular Formula | C26H26ClN3O3 |
| Molecular Weight | 463.97 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 1-(4-chlorobenzoyl)-N-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]piperidine-3-carboxamide |
| SMILES | O=C(NCc1cccc(OCc2ccccn2)c1)C1CCCN(C(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C26H26ClN3O3/c27-22-11-9-20(10-12-22)26(32)30-14-4-6-21(17-30)25(31)29-16-19-5-3-8-24(15-19)33-18-23-7-1-2-13-28-23/h1-3,5,7-13,15,21H,4,6,14,16-18H2,(H,29,31) |
| InChIKey | IIBPRBMBGFZRBU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.97 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |