C19H27ClN2O4 — CID 55712477
3-(4-chlorophenoxy)-N-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]propanamide (PubChem CID 55712477) has the molecular formula C19H27ClN2O4 and a molecular weight of 382.89 g/mol. Its IUPAC name is 3-(4-chlorophenoxy)-N-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]propanamide.
| Compound Name | 3-(4-chlorophenoxy)-N-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 55712477 |
| Molecular Formula | C19H27ClN2O4 |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 3-(4-chlorophenoxy)-N-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]propanamide |
| SMILES | O=C(CCOc1ccc(Cl)cc1)NCC(C1CCOC1)N1CCOCC1 |
| InChI | InChI=1S/C19H27ClN2O4/c20-16-1-3-17(4-2-16)26-10-6-19(23)21-13-18(15-5-9-25-14-15)22-7-11-24-12-8-22/h1-4,15,18H,5-14H2,(H,21,23) |
| InChIKey | CAXWRVJJZVQHNE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |