C20H19Cl2N5O2 — CID 55722123
N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetamide (PubChem CID 55722123) has the molecular formula C20H19Cl2N5O2 and a molecular weight of 432.31 g/mol. Its IUPAC name is N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetamide.
| Compound Name | N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 55722123 |
| Molecular Formula | C20H19Cl2N5O2 |
| Molecular Weight | 432.31 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C(=O)C(=O)NCCNc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C20H19Cl2N5O2/c1-12-17(13(2)27(26-12)15-6-4-3-5-7-15)18(28)20(29)24-9-8-23-19-16(22)10-14(21)11-25-19/h3-7,10-11H,8-9H2,1-2H3,(H,23,25)(H,24,29) |
| InChIKey | CIHKASYXYHHRPZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.31 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|