C19H19N3O4S2 — CID 55722731
N-[4-(furan-2-yl)-1,3-thiazol-2-yl]-2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanylbenzamide (PubChem CID 55722731) has the molecular formula C19H19N3O4S2 and a molecular weight of 417.51 g/mol. Its IUPAC name is N-[4-(furan-2-yl)-1,3-thiazol-2-yl]-2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanylbenzamide.
| Compound Name | N-[4-(furan-2-yl)-1,3-thiazol-2-yl]-2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanylbenzamide |
|---|---|
| PubChem CID | 55722731 |
| Molecular Formula | C19H19N3O4S2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | N-[4-(furan-2-yl)-1,3-thiazol-2-yl]-2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanylbenzamide |
| SMILES | COCCNC(=O)CSc1ccccc1C(=O)Nc1nc(-c2ccco2)cs1 |
| InChI | InChI=1S/C19H19N3O4S2/c1-25-10-8-20-17(23)12-27-16-7-3-2-5-13(16)18(24)22-19-21-14(11-28-19)15-6-4-9-26-15/h2-7,9,11H,8,10,12H2,1H3,(H,20,23)(H,21,22,24) |
| InChIKey | JAWDMDDEZBPWFV-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|