C21H15FN4O — CID 55729057
(E)-N-[2-(4-fluorophenyl)-3H-benzimidazol-5-yl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 55729057) has the molecular formula C21H15FN4O and a molecular weight of 358.38 g/mol. Its IUPAC name is (E)-N-[2-(4-fluorophenyl)-3H-benzimidazol-5-yl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[2-(4-fluorophenyl)-3H-benzimidazol-5-yl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 55729057 |
| Molecular Formula | C21H15FN4O |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | (E)-N-[2-(4-fluorophenyl)-3H-benzimidazol-5-yl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1cccnc1)Nc1ccc2nc(-c3ccc(F)cc3)[nH]c2c1 |
| InChI | InChI=1S/C21H15FN4O/c22-16-6-4-15(5-7-16)21-25-18-9-8-17(12-19(18)26-21)24-20(27)10-3-14-2-1-11-23-13-14/h1-13H,(H,24,27)(H,25,26)/b10-3+ |
| InChIKey | FWJZLWOWNCHZQC-XCVCLJGOSA-N |
| XLogP | 4.42 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|