C18H19N5O2S — CID 55732338
N-[4-oxo-4-[[4-(1,2,4-triazol-1-yl)phenyl]methylamino]butyl]thiophene-2-carboxamide (PubChem CID 55732338) has the molecular formula C18H19N5O2S and a molecular weight of 369.45 g/mol. Its IUPAC name is N-[4-oxo-4-[[4-(1,2,4-triazol-1-yl)phenyl]methylamino]butyl]thiophene-2-carboxamide.
| Compound Name | N-[4-oxo-4-[[4-(1,2,4-triazol-1-yl)phenyl]methylamino]butyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55732338 |
| Molecular Formula | C18H19N5O2S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | N-[4-oxo-4-[[4-(1,2,4-triazol-1-yl)phenyl]methylamino]butyl]thiophene-2-carboxamide |
| SMILES | O=C(CCCNC(=O)c1cccs1)NCc1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C18H19N5O2S/c24-17(4-1-9-20-18(25)16-3-2-10-26-16)21-11-14-5-7-15(8-6-14)23-13-19-12-22-23/h2-3,5-8,10,12-13H,1,4,9,11H2,(H,20,25)(H,21,24) |
| InChIKey | YIUTVLHCTMAWRK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|