C17H17N5O2S — CID 30885035
N-[4-oxo-4-[(2-pyrazol-1-yl-3-pyridinyl)amino]butyl]thiophene-2-carboxamide (PubChem CID 30885035) has the molecular formula C17H17N5O2S and a molecular weight of 355.42 g/mol. Its IUPAC name is N-[4-oxo-4-[(2-pyrazol-1-yl-3-pyridinyl)amino]butyl]thiophene-2-carboxamide.
| Compound Name | N-[4-oxo-4-[(2-pyrazol-1-yl-3-pyridinyl)amino]butyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 30885035 |
| Molecular Formula | C17H17N5O2S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | N-[4-oxo-4-[(2-pyrazol-1-yl-3-pyridinyl)amino]butyl]thiophene-2-carboxamide |
| SMILES | O=C(CCCNC(=O)c1cccs1)Nc1cccnc1-n1cccn1 |
| InChI | InChI=1S/C17H17N5O2S/c23-15(7-2-9-19-17(24)14-6-3-12-25-14)21-13-5-1-8-18-16(13)22-11-4-10-20-22/h1,3-6,8,10-12H,2,7,9H2,(H,19,24)(H,21,23) |
| InChIKey | QEHOAPCHDOSHSI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|