C21H24N4O2 — CID 60584957
5-(2,5-dimethylphenoxy)-N-(2-pyrazol-1-yl-3-pyridinyl)pentanamide (PubChem CID 60584957) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 5-(2,5-dimethylphenoxy)-N-(2-pyrazol-1-yl-3-pyridinyl)pentanamide.
| Compound Name | 5-(2,5-dimethylphenoxy)-N-(2-pyrazol-1-yl-3-pyridinyl)pentanamide |
|---|---|
| PubChem CID | 60584957 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 5-(2,5-dimethylphenoxy)-N-(2-pyrazol-1-yl-3-pyridinyl)pentanamide |
| SMILES | Cc1ccc(C)c(OCCCCC(=O)Nc2cccnc2-n2cccn2)c1 |
| InChI | InChI=1S/C21H24N4O2/c1-16-9-10-17(2)19(15-16)27-14-4-3-8-20(26)24-18-7-5-11-22-21(18)25-13-6-12-23-25/h5-7,9-13,15H,3-4,8,14H2,1-2H3,(H,24,26) |
| InChIKey | HCZXODQBJFLNTG-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|