C18H22BrN3O — CID 55738642
N-(3-bromo-4-methylphenyl)-1-tert-butyl-3-cyclopropylpyrazole-5-carboxamide (PubChem CID 55738642) has the molecular formula C18H22BrN3O and a molecular weight of 376.30 g/mol. Its IUPAC name is N-(3-bromo-4-methylphenyl)-1-tert-butyl-3-cyclopropylpyrazole-5-carboxamide.
| Compound Name | N-(3-bromo-4-methylphenyl)-1-tert-butyl-3-cyclopropylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 55738642 |
| Molecular Formula | C18H22BrN3O |
| Molecular Weight | 376.30 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | N-(3-bromo-4-methylphenyl)-1-tert-butyl-3-cyclopropylpyrazole-5-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cc(C3CC3)nn2C(C)(C)C)cc1Br |
| InChI | InChI=1S/C18H22BrN3O/c1-11-5-8-13(9-14(11)19)20-17(23)16-10-15(12-6-7-12)21-22(16)18(2,3)4/h5,8-10,12H,6-7H2,1-4H3,(H,20,23) |
| InChIKey | PHXKBRUCZAWUBN-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.30 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |