C21H29N3OS — CID 55739359
1-tert-butyl-3-cyclopropyl-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]pyrazole-5-carboxamide (PubChem CID 55739359) has the molecular formula C21H29N3OS and a molecular weight of 371.55 g/mol. Its IUPAC name is 1-tert-butyl-3-cyclopropyl-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]pyrazole-5-carboxamide.
| Compound Name | 1-tert-butyl-3-cyclopropyl-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 55739359 |
| Molecular Formula | C21H29N3OS |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 1-tert-butyl-3-cyclopropyl-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]pyrazole-5-carboxamide |
| SMILES | Cc1ccc(CSCCNC(=O)c2cc(C3CC3)nn2C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H29N3OS/c1-15-5-7-16(8-6-15)14-26-12-11-22-20(25)19-13-18(17-9-10-17)23-24(19)21(2,3)4/h5-8,13,17H,9-12,14H2,1-4H3,(H,22,25) |
| InChIKey | QLKIGQRPCUGMHY-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|