C19H22F3N3O2 — CID 55739146
1-[(2-propan-2-yloxy-3-pyridinyl)methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]urea (PubChem CID 55739146) has the molecular formula C19H22F3N3O2 and a molecular weight of 381.40 g/mol. Its IUPAC name is 1-[(2-propan-2-yloxy-3-pyridinyl)methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]urea.
| Compound Name | 1-[(2-propan-2-yloxy-3-pyridinyl)methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 55739146 |
| Molecular Formula | C19H22F3N3O2 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 1-[(2-propan-2-yloxy-3-pyridinyl)methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]urea |
| SMILES | CC(C)Oc1ncccc1CNC(=O)NCCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H22F3N3O2/c1-13(2)27-17-15(4-3-10-23-17)12-25-18(26)24-11-9-14-5-7-16(8-6-14)19(20,21)22/h3-8,10,13H,9,11-12H2,1-2H3,(H2,24,25,26) |
| InChIKey | AXJRRZBWTGOLLL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |