C21H26ClN5O — CID 55740139
4-[(3-chlorophenyl)methyl]-N-(6-pyrrolidin-1-yl-3-pyridinyl)piperazine-1-carboxamide (PubChem CID 55740139) has the molecular formula C21H26ClN5O and a molecular weight of 399.93 g/mol. Its IUPAC name is 4-[(3-chlorophenyl)methyl]-N-(6-pyrrolidin-1-yl-3-pyridinyl)piperazine-1-carboxamide.
| Compound Name | 4-[(3-chlorophenyl)methyl]-N-(6-pyrrolidin-1-yl-3-pyridinyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 55740139 |
| Molecular Formula | C21H26ClN5O |
| Molecular Weight | 399.93 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 4-[(3-chlorophenyl)methyl]-N-(6-pyrrolidin-1-yl-3-pyridinyl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCC2)nc1)N1CCN(Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C21H26ClN5O/c22-18-5-3-4-17(14-18)16-25-10-12-27(13-11-25)21(28)24-19-6-7-20(23-15-19)26-8-1-2-9-26/h3-7,14-15H,1-2,8-13,16H2,(H,24,28) |
| InChIKey | PQNBAOHVSVZRHX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.93 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |