C24H30N2O5 — CID 55741266
butyl 4-[[2-(2,5-dimethoxyphenyl)pyrrolidine-1-carbonyl]amino]benzoate (PubChem CID 55741266) has the molecular formula C24H30N2O5 and a molecular weight of 426.51 g/mol. Its IUPAC name is butyl 4-[[2-(2,5-dimethoxyphenyl)pyrrolidine-1-carbonyl]amino]benzoate.
| Compound Name | butyl 4-[[2-(2,5-dimethoxyphenyl)pyrrolidine-1-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 55741266 |
| Molecular Formula | C24H30N2O5 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | butyl 4-[[2-(2,5-dimethoxyphenyl)pyrrolidine-1-carbonyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)N2CCCC2c2cc(OC)ccc2OC)cc1 |
| InChI | InChI=1S/C24H30N2O5/c1-4-5-15-31-23(27)17-8-10-18(11-9-17)25-24(28)26-14-6-7-21(26)20-16-19(29-2)12-13-22(20)30-3/h8-13,16,21H,4-7,14-15H2,1-3H3,(H,25,28) |
| InChIKey | AGLOPQPSLPNVGH-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|