C24H33N3OS — CID 55743207
N-[4-(3,5-dimethylpiperidin-1-yl)butyl]-4-(pyridin-3-ylmethylsulfanyl)benzamide (PubChem CID 55743207) has the molecular formula C24H33N3OS and a molecular weight of 411.62 g/mol. Its IUPAC name is N-[4-(3,5-dimethylpiperidin-1-yl)butyl]-4-(pyridin-3-ylmethylsulfanyl)benzamide.
| Compound Name | N-[4-(3,5-dimethylpiperidin-1-yl)butyl]-4-(pyridin-3-ylmethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 55743207 |
| Molecular Formula | C24H33N3OS |
| Molecular Weight | 411.62 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | N-[4-(3,5-dimethylpiperidin-1-yl)butyl]-4-(pyridin-3-ylmethylsulfanyl)benzamide |
| SMILES | CC1CC(C)CN(CCCCNC(=O)c2ccc(SCc3cccnc3)cc2)C1 |
| InChI | InChI=1S/C24H33N3OS/c1-19-14-20(2)17-27(16-19)13-4-3-12-26-24(28)22-7-9-23(10-8-22)29-18-21-6-5-11-25-15-21/h5-11,15,19-20H,3-4,12-14,16-18H2,1-2H3,(H,26,28) |
| InChIKey | YCWQJNPVPMHWPZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.62 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|