C20H22N4O2S — CID 55749353
N-[[3-(2-methylbutanoylamino)phenyl]methyl]-5-thiophen-2-yl-1H-pyrazole-3-carboxamide (PubChem CID 55749353) has the molecular formula C20H22N4O2S and a molecular weight of 382.49 g/mol. Its IUPAC name is N-[[3-(2-methylbutanoylamino)phenyl]methyl]-5-thiophen-2-yl-1H-pyrazole-3-carboxamide.
| Compound Name | N-[[3-(2-methylbutanoylamino)phenyl]methyl]-5-thiophen-2-yl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 55749353 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | N-[[3-(2-methylbutanoylamino)phenyl]methyl]-5-thiophen-2-yl-1H-pyrazole-3-carboxamide |
| SMILES | CCC(C)C(=O)Nc1cccc(CNC(=O)c2cc(-c3cccs3)[nH]n2)c1 |
| InChI | InChI=1S/C20H22N4O2S/c1-3-13(2)19(25)22-15-7-4-6-14(10-15)12-21-20(26)17-11-16(23-24-17)18-8-5-9-27-18/h4-11,13H,3,12H2,1-2H3,(H,21,26)(H,22,25)(H,23,24) |
| InChIKey | MFOSIRCTQARPSM-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |