C17H17N7O3S2 — CID 55753290
ethyl N-[5-[(4,7-dimethyl-5-oxo-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]carbamate (PubChem CID 55753290) has the molecular formula C17H17N7O3S2 and a molecular weight of 431.50 g/mol. Its IUPAC name is ethyl N-[5-[(4,7-dimethyl-5-oxo-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]carbamate.
| Compound Name | ethyl N-[5-[(4,7-dimethyl-5-oxo-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 55753290 |
| Molecular Formula | C17H17N7O3S2 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | ethyl N-[5-[(4,7-dimethyl-5-oxo-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]carbamate |
| SMILES | CCOC(=O)Nc1nnc(SCc2nnc3n(C)c(=O)c4cc(C)ccc4n23)s1 |
| InChI | InChI=1S/C17H17N7O3S2/c1-4-27-16(26)18-14-20-22-17(29-14)28-8-12-19-21-15-23(3)13(25)10-7-9(2)5-6-11(10)24(12)15/h5-7H,4,8H2,1-3H3,(H,18,20,26) |
| InChIKey | SOUVCCMYNDGDGT-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 116.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|