C22H24N4O4 — CID 55755097
N'-[2-(4-ethoxyphenoxy)propanoyl]-5-methyl-1-phenylpyrazole-3-carbohydrazide (PubChem CID 55755097) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is N'-[2-(4-ethoxyphenoxy)propanoyl]-5-methyl-1-phenylpyrazole-3-carbohydrazide.
| Compound Name | N'-[2-(4-ethoxyphenoxy)propanoyl]-5-methyl-1-phenylpyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 55755097 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | N'-[2-(4-ethoxyphenoxy)propanoyl]-5-methyl-1-phenylpyrazole-3-carbohydrazide |
| SMILES | CCOc1ccc(OC(C)C(=O)NNC(=O)c2cc(C)n(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C22H24N4O4/c1-4-29-18-10-12-19(13-11-18)30-16(3)21(27)23-24-22(28)20-14-15(2)26(25-20)17-8-6-5-7-9-17/h5-14,16H,4H2,1-3H3,(H,23,27)(H,24,28) |
| InChIKey | IOQLNCBQTOWYKJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|