C27H35FN2O4 — CID 55756635
1-(3,5-dimethoxybenzoyl)-N-[(4-fluorophenyl)methyl]-N-pentylpiperidine-4-carboxamide (PubChem CID 55756635) has the molecular formula C27H35FN2O4 and a molecular weight of 470.59 g/mol. Its IUPAC name is 1-(3,5-dimethoxybenzoyl)-N-[(4-fluorophenyl)methyl]-N-pentylpiperidine-4-carboxamide.
| Compound Name | 1-(3,5-dimethoxybenzoyl)-N-[(4-fluorophenyl)methyl]-N-pentylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 55756635 |
| Molecular Formula | C27H35FN2O4 |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.26 |
| IUPAC Name | 1-(3,5-dimethoxybenzoyl)-N-[(4-fluorophenyl)methyl]-N-pentylpiperidine-4-carboxamide |
| SMILES | CCCCCN(Cc1ccc(F)cc1)C(=O)C1CCN(C(=O)c2cc(OC)cc(OC)c2)CC1 |
| InChI | InChI=1S/C27H35FN2O4/c1-4-5-6-13-30(19-20-7-9-23(28)10-8-20)26(31)21-11-14-29(15-12-21)27(32)22-16-24(33-2)18-25(17-22)34-3/h7-10,16-18,21H,4-6,11-15,19H2,1-3H3 |
| InChIKey | RCYSSFUHCDQUCZ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|