C19H18Cl3N3O — CID 55766373
2-[1-(4-cyanophenyl)ethyl-ethylamino]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 55766373) has the molecular formula C19H18Cl3N3O and a molecular weight of 410.73 g/mol. Its IUPAC name is 2-[1-(4-cyanophenyl)ethyl-ethylamino]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[1-(4-cyanophenyl)ethyl-ethylamino]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 55766373 |
| Molecular Formula | C19H18Cl3N3O |
| Molecular Weight | 410.73 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | 2-[1-(4-cyanophenyl)ethyl-ethylamino]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | CCN(CC(=O)Nc1cc(Cl)c(Cl)cc1Cl)C(C)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C19H18Cl3N3O/c1-3-25(12(2)14-6-4-13(10-23)5-7-14)11-19(26)24-18-9-16(21)15(20)8-17(18)22/h4-9,12H,3,11H2,1-2H3,(H,24,26) |
| InChIKey | DOHSKLMCZNYLHS-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.73 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|