C14H20ClNO2S — CID 55771779
(1-ethylpiperidin-3-yl) 3-(5-chlorothiophen-2-yl)propanoate (PubChem CID 55771779) has the molecular formula C14H20ClNO2S and a molecular weight of 301.84 g/mol. Its IUPAC name is (1-ethylpiperidin-3-yl) 3-(5-chlorothiophen-2-yl)propanoate.
| Compound Name | (1-ethylpiperidin-3-yl) 3-(5-chlorothiophen-2-yl)propanoate |
|---|---|
| PubChem CID | 55771779 |
| Molecular Formula | C14H20ClNO2S |
| Molecular Weight | 301.84 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | (1-ethylpiperidin-3-yl) 3-(5-chlorothiophen-2-yl)propanoate |
| SMILES | CCN1CCCC(OC(=O)CCc2ccc(Cl)s2)C1 |
| InChI | InChI=1S/C14H20ClNO2S/c1-2-16-9-3-4-11(10-16)18-14(17)8-6-12-5-7-13(15)19-12/h5,7,11H,2-4,6,8-10H2,1H3 |
| InChIKey | PEOJMHRVJUAGBY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.84 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |