(1-ethylpiperidin-3-yl) 3-(5-chlorothiophen-2-yl)propanoate

C14H20ClNO2S — CID 55771779

IUPAC(1-ethylpiperidin-3-yl) 3-(5-chlorothiophen-2-yl)propanoate
SMILESCCN1CCCC(OC(=O)CCc2ccc(Cl)s2)C1
InChIInChI=1S/C14H20ClNO2S/c1-2-16-9-3-4-11(10-16)18-14(17)8-6-12-5-7-13(15)19-12/h5,7,11H,2-4,6,8-10H2,1H3
InChIKeyPEOJMHRVJUAGBY-UHFFFAOYSA-N
MW301.84 g/mol
LogP3.36
Rot. Bonds5

About (1-ethylpiperidin-3-yl) 3-(5-chlorothiophen-2-yl)propanoate

(1-ethylpiperidin-3-yl) 3-(5-chlorothiophen-2-yl)propanoate (PubChem CID 55771779) has the molecular formula C14H20ClNO2S and a molecular weight of 301.84 g/mol. Its IUPAC name is (1-ethylpiperidin-3-yl) 3-(5-chlorothiophen-2-yl)propanoate.

Molecular Properties

Compound Name(1-ethylpiperidin-3-yl) 3-(5-chlorothiophen-2-yl)propanoate
PubChem CID55771779
Molecular FormulaC14H20ClNO2S
Molecular Weight301.84 g/mol
Exact Mass301.09
IUPAC Name(1-ethylpiperidin-3-yl) 3-(5-chlorothiophen-2-yl)propanoate
SMILESCCN1CCCC(OC(=O)CCc2ccc(Cl)s2)C1
InChIInChI=1S/C14H20ClNO2S/c1-2-16-9-3-4-11(10-16)18-14(17)8-6-12-5-7-13(15)19-12/h5,7,11H,2-4,6,8-10H2,1H3
InChIKeyPEOJMHRVJUAGBY-UHFFFAOYSA-N
XLogP3.36
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500301.84
LogP ≤ 53.36
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze (1-ethylpiperidin-3-yl) 3-(5-chlorothiophen-2-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1-ethylpiperidin-3-yl) 3-(5-chlorothiophen-2-yl)propanoate?
The IUPAC name of (1-ethylpiperidin-3-yl) 3-(5-chlorothiophen-2-yl)propanoate (CID 55771779) is (1-ethylpiperidin-3-yl) 3-(5-chlorothiophen-2-yl)propanoate.
What is the SMILES notation for (1-ethylpiperidin-3-yl) 3-(5-chlorothiophen-2-yl)propanoate?
The canonical SMILES for (1-ethylpiperidin-3-yl) 3-(5-chlorothiophen-2-yl)propanoate is CCN1CCCC(OC(=O)CCc2ccc(Cl)s2)C1.
What is the InChIKey of (1-ethylpiperidin-3-yl) 3-(5-chlorothiophen-2-yl)propanoate?
The InChIKey is PEOJMHRVJUAGBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20ClNO2S/c1-2-16-9-3-4-11(10-16)18-14(17)8-6-12-5-7-13(15)19-12/h5,7,11H,2-4,6,8-10H2,1H3.
What are the key properties of (1-ethylpiperidin-3-yl) 3-(5-chlorothiophen-2-yl)propanoate?
(1-ethylpiperidin-3-yl) 3-(5-chlorothiophen-2-yl)propanoate has a molecular weight of 301.84 g/mol, XLogP of 3.36, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethylpiperidin-3-yl) 3-(5-chlorothiophen-2-yl)propanoate is sourced from PubChem (CID 55771779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).