C25H27N3O4S — CID 55772271
N,N-diethyl-1-[3-(pyridin-3-ylmethoxy)benzoyl]-2,3-dihydroindole-5-sulfonamide (PubChem CID 55772271) has the molecular formula C25H27N3O4S and a molecular weight of 465.58 g/mol. Its IUPAC name is N,N-diethyl-1-[3-(pyridin-3-ylmethoxy)benzoyl]-2,3-dihydroindole-5-sulfonamide.
| Compound Name | N,N-diethyl-1-[3-(pyridin-3-ylmethoxy)benzoyl]-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 55772271 |
| Molecular Formula | C25H27N3O4S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | N,N-diethyl-1-[3-(pyridin-3-ylmethoxy)benzoyl]-2,3-dihydroindole-5-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2c(c1)CCN2C(=O)c1cccc(OCc2cccnc2)c1 |
| InChI | InChI=1S/C25H27N3O4S/c1-3-27(4-2)33(30,31)23-10-11-24-20(16-23)12-14-28(24)25(29)21-8-5-9-22(15-21)32-18-19-7-6-13-26-17-19/h5-11,13,15-17H,3-4,12,14,18H2,1-2H3 |
| InChIKey | AVSUCZGQRFVZCB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |