C25H33FN2O4 — CID 55773772
N-[(4-fluorophenyl)methyl]-3-methoxy-4-[2-oxo-2-(propan-2-ylamino)ethoxy]-N-pentylbenzamide (PubChem CID 55773772) has the molecular formula C25H33FN2O4 and a molecular weight of 444.55 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-3-methoxy-4-[2-oxo-2-(propan-2-ylamino)ethoxy]-N-pentylbenzamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-3-methoxy-4-[2-oxo-2-(propan-2-ylamino)ethoxy]-N-pentylbenzamide |
|---|---|
| PubChem CID | 55773772 |
| Molecular Formula | C25H33FN2O4 |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-3-methoxy-4-[2-oxo-2-(propan-2-ylamino)ethoxy]-N-pentylbenzamide |
| SMILES | CCCCCN(Cc1ccc(F)cc1)C(=O)c1ccc(OCC(=O)NC(C)C)c(OC)c1 |
| InChI | InChI=1S/C25H33FN2O4/c1-5-6-7-14-28(16-19-8-11-21(26)12-9-19)25(30)20-10-13-22(23(15-20)31-4)32-17-24(29)27-18(2)3/h8-13,15,18H,5-7,14,16-17H2,1-4H3,(H,27,29) |
| InChIKey | SPAFNAGYASGCII-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|