C21H24N4O4S2 — CID 55774099
N-[4-(1-methoxypropan-2-ylsulfamoyl)phenyl]-3-(2-methylsulfanylimidazol-1-yl)benzamide (PubChem CID 55774099) has the molecular formula C21H24N4O4S2 and a molecular weight of 460.58 g/mol. Its IUPAC name is N-[4-(1-methoxypropan-2-ylsulfamoyl)phenyl]-3-(2-methylsulfanylimidazol-1-yl)benzamide.
| Compound Name | N-[4-(1-methoxypropan-2-ylsulfamoyl)phenyl]-3-(2-methylsulfanylimidazol-1-yl)benzamide |
|---|---|
| PubChem CID | 55774099 |
| Molecular Formula | C21H24N4O4S2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | N-[4-(1-methoxypropan-2-ylsulfamoyl)phenyl]-3-(2-methylsulfanylimidazol-1-yl)benzamide |
| SMILES | COCC(C)NS(=O)(=O)c1ccc(NC(=O)c2cccc(-n3ccnc3SC)c2)cc1 |
| InChI | InChI=1S/C21H24N4O4S2/c1-15(14-29-2)24-31(27,28)19-9-7-17(8-10-19)23-20(26)16-5-4-6-18(13-16)25-12-11-22-21(25)30-3/h4-13,15,24H,14H2,1-3H3,(H,23,26) |
| InChIKey | NIEIEXKLYJOGKM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |