C23H28N2O3S2 — CID 55777117
3-[4-(azepan-1-ylsulfonyl)phenyl]-1-(2-thiophen-3-ylpyrrolidin-1-yl)prop-2-en-1-one (PubChem CID 55777117) has the molecular formula C23H28N2O3S2 and a molecular weight of 444.62 g/mol. Its IUPAC name is 3-[4-(azepan-1-ylsulfonyl)phenyl]-1-(2-thiophen-3-ylpyrrolidin-1-yl)prop-2-en-1-one.
| Compound Name | 3-[4-(azepan-1-ylsulfonyl)phenyl]-1-(2-thiophen-3-ylpyrrolidin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 55777117 |
| Molecular Formula | C23H28N2O3S2 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 3-[4-(azepan-1-ylsulfonyl)phenyl]-1-(2-thiophen-3-ylpyrrolidin-1-yl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc(S(=O)(=O)N2CCCCCC2)cc1)N1CCCC1c1ccsc1 |
| InChI | InChI=1S/C23H28N2O3S2/c26-23(25-16-5-6-22(25)20-13-17-29-18-20)12-9-19-7-10-21(11-8-19)30(27,28)24-14-3-1-2-4-15-24/h7-13,17-18,22H,1-6,14-16H2 |
| InChIKey | QVYWIKGBKUJPJH-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|