C17H26N2O3S2 — CID 55714417
(1-propylsulfonylpiperidin-3-yl)-(2-thiophen-3-ylpyrrolidin-1-yl)methanone (PubChem CID 55714417) has the molecular formula C17H26N2O3S2 and a molecular weight of 370.54 g/mol. Its IUPAC name is (1-propylsulfonylpiperidin-3-yl)-(2-thiophen-3-ylpyrrolidin-1-yl)methanone.
| Compound Name | (1-propylsulfonylpiperidin-3-yl)-(2-thiophen-3-ylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 55714417 |
| Molecular Formula | C17H26N2O3S2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | (1-propylsulfonylpiperidin-3-yl)-(2-thiophen-3-ylpyrrolidin-1-yl)methanone |
| SMILES | CCCS(=O)(=O)N1CCCC(C(=O)N2CCCC2c2ccsc2)C1 |
| InChI | InChI=1S/C17H26N2O3S2/c1-2-11-24(21,22)18-8-3-5-14(12-18)17(20)19-9-4-6-16(19)15-7-10-23-13-15/h7,10,13-14,16H,2-6,8-9,11-12H2,1H3 |
| InChIKey | NTYUWNAGCDPAQA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |