C19H21N3O5 — CID 55783641
2-(4-cyano-2-methoxyphenoxy)-N-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]acetamide (PubChem CID 55783641) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is 2-(4-cyano-2-methoxyphenoxy)-N-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]acetamide.
| Compound Name | 2-(4-cyano-2-methoxyphenoxy)-N-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]acetamide |
|---|---|
| PubChem CID | 55783641 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 2-(4-cyano-2-methoxyphenoxy)-N-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]acetamide |
| SMILES | COCCOc1ccc(CNC(=O)COc2ccc(C#N)cc2OC)cn1 |
| InChI | InChI=1S/C19H21N3O5/c1-24-7-8-26-19-6-4-15(12-22-19)11-21-18(23)13-27-16-5-3-14(10-20)9-17(16)25-2/h3-6,9,12H,7-8,11,13H2,1-2H3,(H,21,23) |
| InChIKey | QJRIXBRBBNULEA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 102.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|