C20H25N3O6 — CID 55844557
3,4-dimethoxy-N-[2-[[6-(2-methoxyethoxy)-3-pyridinyl]methylamino]-2-oxoethyl]benzamide (PubChem CID 55844557) has the molecular formula C20H25N3O6 and a molecular weight of 403.44 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[2-[[6-(2-methoxyethoxy)-3-pyridinyl]methylamino]-2-oxoethyl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[2-[[6-(2-methoxyethoxy)-3-pyridinyl]methylamino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 55844557 |
| Molecular Formula | C20H25N3O6 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 3,4-dimethoxy-N-[2-[[6-(2-methoxyethoxy)-3-pyridinyl]methylamino]-2-oxoethyl]benzamide |
| SMILES | COCCOc1ccc(CNC(=O)CNC(=O)c2ccc(OC)c(OC)c2)cn1 |
| InChI | InChI=1S/C20H25N3O6/c1-26-8-9-29-19-7-4-14(12-22-19)11-21-18(24)13-23-20(25)15-5-6-16(27-2)17(10-15)28-3/h4-7,10,12H,8-9,11,13H2,1-3H3,(H,21,24)(H,23,25) |
| InChIKey | GDDSXTGMEXYCIX-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|