C21H21N5O3 — CID 55795593
4-(4-cyano-2-methoxyphenoxy)-N-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]butanamide (PubChem CID 55795593) has the molecular formula C21H21N5O3 and a molecular weight of 391.43 g/mol. Its IUPAC name is 4-(4-cyano-2-methoxyphenoxy)-N-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]butanamide.
| Compound Name | 4-(4-cyano-2-methoxyphenoxy)-N-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 55795593 |
| Molecular Formula | C21H21N5O3 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 4-(4-cyano-2-methoxyphenoxy)-N-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]butanamide |
| SMILES | COc1cc(C#N)ccc1OCCCC(=O)NCc1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C21H21N5O3/c1-28-20-11-17(12-22)6-9-19(20)29-10-2-3-21(27)24-13-16-4-7-18(8-5-16)26-15-23-14-25-26/h4-9,11,14-15H,2-3,10,13H2,1H3,(H,24,27) |
| InChIKey | DCJZRKRKAQELCM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|