C20H25ClN4O2 — CID 55803550
4-(4-chloro-3-methylphenoxy)-N-(1-pyrimidin-2-ylpiperidin-3-yl)butanamide (PubChem CID 55803550) has the molecular formula C20H25ClN4O2 and a molecular weight of 388.90 g/mol. Its IUPAC name is 4-(4-chloro-3-methylphenoxy)-N-(1-pyrimidin-2-ylpiperidin-3-yl)butanamide.
| Compound Name | 4-(4-chloro-3-methylphenoxy)-N-(1-pyrimidin-2-ylpiperidin-3-yl)butanamide |
|---|---|
| PubChem CID | 55803550 |
| Molecular Formula | C20H25ClN4O2 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 4-(4-chloro-3-methylphenoxy)-N-(1-pyrimidin-2-ylpiperidin-3-yl)butanamide |
| SMILES | Cc1cc(OCCCC(=O)NC2CCCN(c3ncccn3)C2)ccc1Cl |
| InChI | InChI=1S/C20H25ClN4O2/c1-15-13-17(7-8-18(15)21)27-12-3-6-19(26)24-16-5-2-11-25(14-16)20-22-9-4-10-23-20/h4,7-10,13,16H,2-3,5-6,11-12,14H2,1H3,(H,24,26) |
| InChIKey | QLKYFKVUDHNWQS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|