C25H30N4O4 — CID 55809815
1-[2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanoyl]-N-(5-methyl-2-pyridinyl)piperidine-4-carboxamide (PubChem CID 55809815) has the molecular formula C25H30N4O4 and a molecular weight of 450.54 g/mol. Its IUPAC name is 1-[2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanoyl]-N-(5-methyl-2-pyridinyl)piperidine-4-carboxamide.
| Compound Name | 1-[2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanoyl]-N-(5-methyl-2-pyridinyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55809815 |
| Molecular Formula | C25H30N4O4 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | 1-[2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanoyl]-N-(5-methyl-2-pyridinyl)piperidine-4-carboxamide |
| SMILES | COc1ccc(C=CC(=O)NC(C)C(=O)N2CCC(C(=O)Nc3ccc(C)cn3)CC2)cc1 |
| InChI | InChI=1S/C25H30N4O4/c1-17-4-10-22(26-16-17)28-24(31)20-12-14-29(15-13-20)25(32)18(2)27-23(30)11-7-19-5-8-21(33-3)9-6-19/h4-11,16,18,20H,12-15H2,1-3H3,(H,27,30)(H,26,28,31) |
| InChIKey | YLTUIAICUPNSJE-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|