C23H33N3O5 — CID 55954329
1-[2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanoyl]-N-(3-methoxypropyl)piperidine-4-carboxamide (PubChem CID 55954329) has the molecular formula C23H33N3O5 and a molecular weight of 431.53 g/mol. Its IUPAC name is 1-[2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanoyl]-N-(3-methoxypropyl)piperidine-4-carboxamide.
| Compound Name | 1-[2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanoyl]-N-(3-methoxypropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55954329 |
| Molecular Formula | C23H33N3O5 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | 1-[2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanoyl]-N-(3-methoxypropyl)piperidine-4-carboxamide |
| SMILES | COCCCNC(=O)C1CCN(C(=O)C(C)NC(=O)C=Cc2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C23H33N3O5/c1-17(25-21(27)10-7-18-5-8-20(31-3)9-6-18)23(29)26-14-11-19(12-15-26)22(28)24-13-4-16-30-2/h5-10,17,19H,4,11-16H2,1-3H3,(H,24,28)(H,25,27) |
| InChIKey | HYFSBMXWYBGDNM-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|