C23H28N4O4S — CID 55951132
1-[2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanoyl]-N-(4-methyl-1,3-thiazol-2-yl)piperidine-4-carboxamide (PubChem CID 55951132) has the molecular formula C23H28N4O4S and a molecular weight of 456.57 g/mol. Its IUPAC name is 1-[2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanoyl]-N-(4-methyl-1,3-thiazol-2-yl)piperidine-4-carboxamide.
| Compound Name | 1-[2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanoyl]-N-(4-methyl-1,3-thiazol-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55951132 |
| Molecular Formula | C23H28N4O4S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 1-[2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanoyl]-N-(4-methyl-1,3-thiazol-2-yl)piperidine-4-carboxamide |
| SMILES | COc1ccc(C=CC(=O)NC(C)C(=O)N2CCC(C(=O)Nc3nc(C)cs3)CC2)cc1 |
| InChI | InChI=1S/C23H28N4O4S/c1-15-14-32-23(24-15)26-21(29)18-10-12-27(13-11-18)22(30)16(2)25-20(28)9-6-17-4-7-19(31-3)8-5-17/h4-9,14,16,18H,10-13H2,1-3H3,(H,25,28)(H,24,26,29) |
| InChIKey | FWLVIZSLUDJQEX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|